CAS 1315571-18-6 is the registry number for 2-(4-Bromophenyl)-6-chlorobenzo[d]oxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromophenyl)-6-chloro-1,3-benzoxazole (CAS 1315571-18-6) is a chemical compound with the molecular formula C13H7BrClNO and a molecular weight of 308.56 g/mol. IUPAC name: 2-(4-bromophenyl)-6-chloro-1,3-benzoxazole. InChIKey: VHAZXMTXNWUQCY-UHFFFAOYSA-N.
| Molecular formula | C13H7BrClNO |
|---|---|
| Molecular weight | 308.56 g/mol |
| IUPAC name | 2-(4-bromophenyl)-6-chloro-1,3-benzoxazole |
| InChIKey | VHAZXMTXNWUQCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=C(C=C3)Cl)Br |
Computed by PubChem (NCBI)