Products 122357-34-0

CAS 122357-34-0 is the registry number for 1-Benzyl-1,6-diazaspiro(3.3)heptane oxalate (2:1), 95+%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Bis(1-benzyl-1,6-diazaspiro[3.3]heptane);oxalic acid (CAS 122357-34-0) is a chemical compound with the molecular formula C26H34N4O4 and a molecular weight of 466.6 g/mol. IUPAC name: bis(1-benzyl-1,6-diazaspiro[3.3]heptane);oxalic acid. InChIKey: HVUDRUUOMXDHMA-UHFFFAOYSA-N.

Identity
Molecular formulaC26H34N4O4
Molecular weight466.6 g/mol
IUPAC namebis(1-benzyl-1,6-diazaspiro[3.3]heptane);oxalic acid
InChIKeyHVUDRUUOMXDHMA-UHFFFAOYSA-N
SMILESC1CN(C12CNC2)CC3=CC=CC=C3.C1CN(C12CNC2)CC3=CC=CC=C3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)