CAS 1523606-27-0 is the registry number for 2-Benzyl-2,6-diazaspiro[3.3]heptane hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Bis(2-benzyl-2,6-diazaspiro[3.3]heptane);oxalic acid (CAS 1523606-27-0) is a chemical compound with the molecular formula C26H34N4O4 and a molecular weight of 466.6 g/mol. IUPAC name: bis(2-benzyl-2,6-diazaspiro[3.3]heptane);oxalic acid. InChIKey: LNQIBAFXMHMMLI-UHFFFAOYSA-N.
| Molecular formula | C26H34N4O4 |
|---|---|
| Molecular weight | 466.6 g/mol |
| IUPAC name | bis(2-benzyl-2,6-diazaspiro[3.3]heptane);oxalic acid |
| InChIKey | LNQIBAFXMHMMLI-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)CC3=CC=CC=C3.C1C2(CN1)CN(C2)CC3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)