CAS 1223748-38-6 is the registry number for 3,5-Bis(benzo[d]oxazol-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-(1,3-benzoxazol-2-yl)-3-pyridinyl]-1,3-benzoxazole (CAS 1223748-38-6) is a chemical compound with the molecular formula C19H11N3O2 and a molecular weight of 313.3 g/mol. IUPAC name: 2-[5-(1,3-benzoxazol-2-yl)-3-pyridinyl]-1,3-benzoxazole. InChIKey: GIADVFNOWQYXSX-UHFFFAOYSA-N.
| Molecular formula | C19H11N3O2 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | 2-[5-(1,3-benzoxazol-2-yl)-3-pyridinyl]-1,3-benzoxazole |
| InChIKey | GIADVFNOWQYXSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC(=CN=C3)C4=NC5=CC=CC=C5O4 |
Computed by PubChem (NCBI)