CAS 33858-36-5 appears in our catalog under these names: 2,6–Bis(benzo(d)oxazol–2–yl)pyridine, 2,6-Bis(benzo[d]oxazol-2-yl)pyridine, 98%, 98%, 2,6-Bis(benzo[d]oxazol-2-yl)pyridine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[6-(1,3-benzoxazol-2-yl)-2-pyridinyl]-1,3-benzoxazole (CAS 33858-36-5) is a chemical compound with the molecular formula C19H11N3O2 and a molecular weight of 313.3 g/mol. IUPAC name: 2-[6-(1,3-benzoxazol-2-yl)-2-pyridinyl]-1,3-benzoxazole. InChIKey: LABDAMKZNFRJIA-UHFFFAOYSA-N.
| Molecular formula | C19H11N3O2 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | 2-[6-(1,3-benzoxazol-2-yl)-2-pyridinyl]-1,3-benzoxazole |
| InChIKey | LABDAMKZNFRJIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=NC(=CC=C3)C4=NC5=CC=CC=C5O4 |
Computed by PubChem (NCBI)