CAS 122375-70-6 appears in our catalog under these names: 3-Amino-5-phenylthiophene-2-carboxamide, 95%, 3-Amino-5-phenylthiophene-2-carboxamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-amino-5-phenylthiophene-2-carboxamide (CAS 122375-70-6) is a chemical compound with the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. IUPAC name: 3-amino-5-phenylthiophene-2-carboxamide. InChIKey: DYRYDYQWWQHRQE-UHFFFAOYSA-N.
| Molecular formula | C11H10N2OS |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 3-amino-5-phenylthiophene-2-carboxamide |
| InChIKey | DYRYDYQWWQHRQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(S2)C(=O)N)N |
Computed by PubChem (NCBI)