CAS 1223888-72-9 is the registry number for 4,6-Dimethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,2-dihydropyridin-2-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,6-dimethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one (CAS 1223888-72-9) is a chemical compound with the molecular formula C15H13N3O2 and a molecular weight of 267.28 g/mol. IUPAC name: 4,6-dimethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one. InChIKey: DPAWXWIVSGYAEL-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 4,6-dimethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one |
| InChIKey | DPAWXWIVSGYAEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C2=NC(=NO2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)