Products 140397-85-9
CAS 140397-85-9 is the registry number for 3-(4-Methoxyphenyl)-1-pyridin-2-yl-1h-pyrazol-5-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5-(4-methoxyphenyl)-2-pyridin-2-yl-1H-pyrazol-3-one (CAS 140397-85-9) is a chemical compound with the molecular formula C15H13N3O2 and a molecular weight of 267.28 g/mol. IUPAC name: 5-(4-methoxyphenyl)-2-pyridin-2-yl-1H-pyrazol-3-one. InChIKey: OUIRWMVIPWWDQN-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-2-pyridin-2-yl-1H-pyrazol-3-one |
| InChIKey | OUIRWMVIPWWDQN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)N(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)