CAS 1223889-44-8 is the registry number for 5-(3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl)pyridin-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one (CAS 1223889-44-8) is a chemical compound with the molecular formula C13H8ClN3O2 and a molecular weight of 273.67 g/mol. IUPAC name: 5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one. InChIKey: NGIWITZPQYRZFW-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3O2 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one |
| InChIKey | NGIWITZPQYRZFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=N2)C3=CNC(=O)C=C3 |
Computed by PubChem (NCBI)