Products 90353-66-5
CAS 90353-66-5 is the registry number for 8-Chloro-5,10-dihydro-5-nitroso-11H-dibenzo(b,e)(1,4)diazepin-11-one. Offered by: TRC. Available pack sizes: 50mg.
3-chloro-11-nitroso-5H-benzo[b][1,4]benzodiazepin-6-one (CAS 90353-66-5) is a chemical compound with the molecular formula C13H8ClN3O2 and a molecular weight of 273.67 g/mol. IUPAC name: 3-chloro-11-nitroso-5H-benzo[b][1,4]benzodiazepin-6-one. InChIKey: WYCFOCJRCMOUNT-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3O2 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 3-chloro-11-nitroso-5H-benzo[b][1,4]benzodiazepin-6-one |
| InChIKey | WYCFOCJRCMOUNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(N2N=O)C=CC(=C3)Cl |
Computed by PubChem (NCBI)