CAS 1224164-25-3 is the registry number for FabH-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[C-[(4-fluorophenyl)methyl]-N-(4-methylphenyl)carbonimidoyl]benzene-1,2,3-triol (CAS 1224164-25-3) is a chemical compound with the molecular formula C21H18FNO3 and a molecular weight of 351.4 g/mol. IUPAC name: 4-[C-[(4-fluorophenyl)methyl]-N-(4-methylphenyl)carbonimidoyl]benzene-1,2,3-triol. InChIKey: NWDGLLMNPPWKRA-UHFFFAOYSA-N.
| Molecular formula | C21H18FNO3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-[C-[(4-fluorophenyl)methyl]-N-(4-methylphenyl)carbonimidoyl]benzene-1,2,3-triol |
| InChIKey | NWDGLLMNPPWKRA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=C(CC2=CC=C(C=C2)F)C3=C(C(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)