CAS 2996821-62-4 is the registry number for AF-2112, 99.82%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 5 mg, 10 mg, 10mM/1mL, 50 mg.
4-fluoro-2-[3-(2-phenylethoxy)anilino]benzoic acid (CAS 2996821-62-4) is a chemical compound with the molecular formula C21H18FNO3 and a molecular weight of 351.4 g/mol. IUPAC name: 4-fluoro-2-[3-(2-phenylethoxy)anilino]benzoic acid. InChIKey: ABXYQZXEVULDHP-UHFFFAOYSA-N.
| Molecular formula | C21H18FNO3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-fluoro-2-[3-(2-phenylethoxy)anilino]benzoic acid |
| InChIKey | ABXYQZXEVULDHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCOC2=CC=CC(=C2)NC3=C(C=CC(=C3)F)C(=O)O |
Computed by PubChem (NCBI)