Products 2996821-62-4

CAS 2996821-62-4 is the registry number for AF-2112, 99.82%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 5 mg, 10 mg, 10mM/1mL, 50 mg.

Structural formula: {0} (CAS {1})

4-fluoro-2-[3-(2-phenylethoxy)anilino]benzoic acid (CAS 2996821-62-4) is a chemical compound with the molecular formula C21H18FNO3 and a molecular weight of 351.4 g/mol. IUPAC name: 4-fluoro-2-[3-(2-phenylethoxy)anilino]benzoic acid. InChIKey: ABXYQZXEVULDHP-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18FNO3
Molecular weight351.4 g/mol
IUPAC name4-fluoro-2-[3-(2-phenylethoxy)anilino]benzoic acid
InChIKeyABXYQZXEVULDHP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCOC2=CC=CC(=C2)NC3=C(C=CC(=C3)F)C(=O)O

Computed by PubChem (NCBI)

Synonyms: orb2277951