Products 1224588-66-2
CAS 1224588-66-2 appears in our catalog under these names: Formoterol Impurity 2（Formoterol EP Impurity B）, Formoterol EP Impurity B, Formoterol EP Impurity B, >95% (HPLC), C-Demethyl formoterol hemifumarate. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1mg, 5mg.
N-[2-hydroxy-5-[1-hydroxy-2-[2-(4-methoxyphenyl)ethylamino]ethyl]phenyl]formamide (CAS 1224588-66-2) is a chemical compound with the molecular formula C18H22N2O4 and a molecular weight of 330.4 g/mol. IUPAC name: N-[2-hydroxy-5-[1-hydroxy-2-[2-(4-methoxyphenyl)ethylamino]ethyl]phenyl]formamide. InChIKey: GLFNPNBHWOMHBI-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | N-[2-hydroxy-5-[1-hydroxy-2-[2-(4-methoxyphenyl)ethylamino]ethyl]phenyl]formamide |
| InChIKey | GLFNPNBHWOMHBI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CCNCC(C2=CC(=C(C=C2)O)NC=O)O |
Computed by PubChem (NCBI)