CAS 1224604-19-6 appears in our catalog under these names: 3,5-Dibromo-1-fluoro-4-isopropoxybenzene, 97%, 3,5-Dibromo-1-fluoro-4-isopropoxybenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
1,3-dibromo-5-fluoro-2-propan-2-yloxybenzene (CAS 1224604-19-6) is a chemical compound with the molecular formula C9H9Br2FO and a molecular weight of 311.97 g/mol. IUPAC name: 1,3-dibromo-5-fluoro-2-propan-2-yloxybenzene. InChIKey: CUWJTUGTPSDUMD-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2FO |
|---|---|
| Molecular weight | 311.97 g/mol |
| IUPAC name | 1,3-dibromo-5-fluoro-2-propan-2-yloxybenzene |
| InChIKey | CUWJTUGTPSDUMD-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)F)Br |
Computed by PubChem (NCBI)