Products 3002441-94-0
CAS 3002441-94-0 is the registry number for 2-(3,5-dibromo-2-fluorophenyl)propan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3,5-dibromo-2-fluorophenyl)propan-2-ol (CAS 3002441-94-0) is a chemical compound with the molecular formula C9H9Br2FO and a molecular weight of 311.97 g/mol. IUPAC name: 2-(3,5-dibromo-2-fluorophenyl)propan-2-ol. InChIKey: MXYUOTBSWYKOFJ-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2FO |
|---|---|
| Molecular weight | 311.97 g/mol |
| IUPAC name | 2-(3,5-dibromo-2-fluorophenyl)propan-2-ol |
| InChIKey | MXYUOTBSWYKOFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=CC(=C1)Br)Br)F)O |
Computed by PubChem (NCBI)