CAS 1224893-33-7 is the registry number for N-(3-Bromophenyl)-N-phenyl-1-naphthalenamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(3-bromophenyl)-N-phenylnaphthalen-1-amine (CAS 1224893-33-7) is a chemical compound with the molecular formula C22H16BrN and a molecular weight of 374.3 g/mol. IUPAC name: N-(3-bromophenyl)-N-phenylnaphthalen-1-amine. InChIKey: RZPIJOXIECJHAV-UHFFFAOYSA-N.
| Molecular formula | C22H16BrN |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | N-(3-bromophenyl)-N-phenylnaphthalen-1-amine |
| InChIKey | RZPIJOXIECJHAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC(=CC=C2)Br)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)