CAS 227314-47-8 is the registry number for 4-Bromo-N,N-diphenylnaphthalen-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N,N-diphenylnaphthalen-1-amine (CAS 227314-47-8) is a chemical compound with the molecular formula C22H16BrN and a molecular weight of 374.3 g/mol. IUPAC name: 4-bromo-N,N-diphenylnaphthalen-1-amine. InChIKey: AFFYQFMETFBWIS-UHFFFAOYSA-N.
| Molecular formula | C22H16BrN |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 4-bromo-N,N-diphenylnaphthalen-1-amine |
| InChIKey | AFFYQFMETFBWIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C4=CC=CC=C43)Br |
Computed by PubChem (NCBI)