CAS 1224935-34-5 is the registry number for 3,3'-(1,3-Phenylenebis(ethyne-2,1-diyl))dibenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-[3-[2-(3-carboxyphenyl)ethynyl]phenyl]ethynyl]benzoic acid (CAS 1224935-34-5) is a chemical compound with the molecular formula C24H14O4 and a molecular weight of 366.4 g/mol. IUPAC name: 3-[2-[3-[2-(3-carboxyphenyl)ethynyl]phenyl]ethynyl]benzoic acid. InChIKey: NRNMNOGFCMLIFM-UHFFFAOYSA-N.
| Molecular formula | C24H14O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 3-[2-[3-[2-(3-carboxyphenyl)ethynyl]phenyl]ethynyl]benzoic acid |
| InChIKey | NRNMNOGFCMLIFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#CC2=CC(=CC=C2)C(=O)O)C#CC3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)