CAS 217077-89-9 appears in our catalog under these names: 4,4'–(1,4–Phenylenebis(ethyne–2,1–diyl))dibenzoic acid, 4,4'-[1,4-Phenylenebis(Ethyne-2,1-diyl)]dibenzoic acid 98%, 4,4'-[1,4-Phenylenebis(Ethyne-2,1-diyl)]dibenzoic acid, 98%, 98%, 4,4'-[1,4-PHENYLENEBIS(ETHYNE-2,1-DIYL)]DIBENZOIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[2-[4-[2-(4-carboxyphenyl)ethynyl]phenyl]ethynyl]benzoic acid (CAS 217077-89-9) is a chemical compound with the molecular formula C24H14O4 and a molecular weight of 366.4 g/mol. IUPAC name: 4-[2-[4-[2-(4-carboxyphenyl)ethynyl]phenyl]ethynyl]benzoic acid. InChIKey: PBSHZURLUZZSFJ-UHFFFAOYSA-N.
| Molecular formula | C24H14O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 4-[2-[4-[2-(4-carboxyphenyl)ethynyl]phenyl]ethynyl]benzoic acid |
| InChIKey | PBSHZURLUZZSFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)C(=O)O)C#CC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)