CAS 1224946-21-7 is the registry number for 3-(aza((4-nitrophenyl)amino)methylene)indolin-2-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-[(4-nitrophenyl)diazenyl]-1H-indol-2-ol (CAS 1224946-21-7) is a chemical compound with the molecular formula C14H10N4O3 and a molecular weight of 282.25 g/mol. IUPAC name: 3-[(4-nitrophenyl)diazenyl]-1H-indol-2-ol. InChIKey: HHJYHWPKXWRLIE-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O3 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 3-[(4-nitrophenyl)diazenyl]-1H-indol-2-ol |
| InChIKey | HHJYHWPKXWRLIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=NC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)