Products 19747-13-8

CAS 19747-13-8 is the registry number for 3-(Furan-2-yl)-2-(5-phenyl-1H-1,2,3,4-tetrazol-1-yl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoic acid (CAS 19747-13-8) is a chemical compound with the molecular formula C14H10N4O3 and a molecular weight of 282.25 g/mol. IUPAC name: 3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoic acid. InChIKey: YVQAGBCKIDNFLC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10N4O3
Molecular weight282.25 g/mol
IUPAC name3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enoic acid
InChIKeyYVQAGBCKIDNFLC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NN=NN2C(=CC3=CC=CO3)C(=O)O

Computed by PubChem (NCBI)