Products 1225065-12-2
CAS 1225065-12-2 is the registry number for 4-Bromo-3,5-dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-bromo-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole (CAS 1225065-12-2) is a chemical compound with the molecular formula C7H8BrF3N2 and a molecular weight of 257.05 g/mol. IUPAC name: 4-bromo-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole. InChIKey: IBLIYXMGFLKLDY-UHFFFAOYSA-N.
| Molecular formula | C7H8BrF3N2 |
|---|---|
| Molecular weight | 257.05 g/mol |
| IUPAC name | 4-bromo-3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole |
| InChIKey | IBLIYXMGFLKLDY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)(F)F)C)Br |
Computed by PubChem (NCBI)