CAS 1256962-73-8 appears in our catalog under these names: 4-Bromo-5-iso-propyl-3-(trifluoromethyl)-1h-pyrazole, 95%, 4–Bromo–5–iso–propyl–3–(trifluoromethyl)–1H–Pyrazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-5-propan-2-yl-3-(trifluoromethyl)-1H-pyrazole (CAS 1256962-73-8) is a chemical compound with the molecular formula C7H8BrF3N2 and a molecular weight of 257.05 g/mol. IUPAC name: 4-bromo-5-propan-2-yl-3-(trifluoromethyl)-1H-pyrazole. InChIKey: MVMBRPNKIMFBEZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BrF3N2 |
|---|---|
| Molecular weight | 257.05 g/mol |
| IUPAC name | 4-bromo-5-propan-2-yl-3-(trifluoromethyl)-1H-pyrazole |
| InChIKey | MVMBRPNKIMFBEZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NN1)C(F)(F)F)Br |
Computed by PubChem (NCBI)