CAS 1225278-65-8 appears in our catalog under these names: Benzenamine, 4-[(2-chloro-4-pyridinyl)oxy]-2,5-difluoro-, 95%, Benzenamine, 4-((2-chloro-4-pyridinyl)oxy)-2,5-difluoro-, 98%, Benzenamine, 4-[(2-chloro-4-pyridinyl)oxy]-2,5-difluoro-, 97%, 97%, 4-[(2-Chloropyridin-4-yl)oxy]-2,5-difluorobenzenamine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg.
4-[(2-chloro-4-pyridinyl)oxy]-2,5-difluoroaniline (CAS 1225278-65-8) is a chemical compound with the molecular formula C11H7ClF2N2O and a molecular weight of 256.63 g/mol. IUPAC name: 4-[(2-chloro-4-pyridinyl)oxy]-2,5-difluoroaniline. InChIKey: UGOHGIBWMNXIOM-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF2N2O |
|---|---|
| Molecular weight | 256.63 g/mol |
| IUPAC name | 4-[(2-chloro-4-pyridinyl)oxy]-2,5-difluoroaniline |
| InChIKey | UGOHGIBWMNXIOM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1OC2=C(C=C(C(=C2)F)N)F)Cl |
Computed by PubChem (NCBI)