CAS 1515197-22-4 is the registry number for 5-Chloro-2-(2,4-difluorophenoxy)pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-chloro-2-(2,4-difluorophenoxy)pyridin-3-amine (CAS 1515197-22-4) is a chemical compound with the molecular formula C11H7ClF2N2O and a molecular weight of 256.63 g/mol. IUPAC name: 5-chloro-2-(2,4-difluorophenoxy)pyridin-3-amine. InChIKey: OWMBCLMPGCHQHT-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF2N2O |
|---|---|
| Molecular weight | 256.63 g/mol |
| IUPAC name | 5-chloro-2-(2,4-difluorophenoxy)pyridin-3-amine |
| InChIKey | OWMBCLMPGCHQHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)OC2=C(C=C(C=N2)Cl)N |
Computed by PubChem (NCBI)