Products 1225286-62-3

CAS 1225286-62-3 appears in our catalog under these names: 2-(Thiazol-4-yl)acetic acid hydrochloride, 95+%, 2-(Thiazol-4-yl)acetic acid hydrochloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(1,3-thiazol-4-yl)acetic acid;hydrochloride (CAS 1225286-62-3) is a chemical compound with the molecular formula C5H6ClNO2S and a molecular weight of 179.63 g/mol. IUPAC name: 2-(1,3-thiazol-4-yl)acetic acid;hydrochloride. InChIKey: XNWMOBQIRBVDBP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6ClNO2S
Molecular weight179.63 g/mol
IUPAC name2-(1,3-thiazol-4-yl)acetic acid;hydrochloride
InChIKeyXNWMOBQIRBVDBP-UHFFFAOYSA-N
SMILESC1=C(N=CS1)CC(=O)O.Cl

Computed by PubChem (NCBI)