Products 1311043-74-9

CAS 1311043-74-9 is the registry number for 2-Methyl-1,3-thiazole-4-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-methyl-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 1311043-74-9) is a chemical compound with the molecular formula C5H6ClNO2S and a molecular weight of 179.63 g/mol. IUPAC name: 2-methyl-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: MVWRGBRXXNHTCT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6ClNO2S
Molecular weight179.63 g/mol
IUPAC name2-methyl-1,3-thiazole-4-carboxylic acid;hydrochloride
InChIKeyMVWRGBRXXNHTCT-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)C(=O)O.Cl

Computed by PubChem (NCBI)