CAS 1225443-54-8 is the registry number for 1,2,3,9-Tetrahydro-9-(methyl-d3)-4H-carbazol-4-one. Offered by: TRC. Available pack sizes: 250mg, 25mg.
9-(trideuteriomethyl)-2,3-dihydro-1H-carbazol-4-one (CAS 1225443-54-8) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 202.27 g/mol. IUPAC name: 9-(trideuteriomethyl)-2,3-dihydro-1H-carbazol-4-one. InChIKey: HHJUJCWZKJMCLC-FIBGUPNXSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 9-(trideuteriomethyl)-2,3-dihydro-1H-carbazol-4-one |
| InChIKey | HHJUJCWZKJMCLC-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C(=O)CCC2)C3=CC=CC=C31 |
Computed by PubChem (NCBI)