CAS 1225453-72-4 is the registry number for Lumiracoxib–d6. Offered by: GLPBio. Available pack sizes: 10mg.
2-[2-(2-chloro-6-fluoroanilino)-3,4,6-trideuterio-5-(trideuteriomethyl)phenyl]acetic acid (CAS 1225453-72-4) is a chemical compound with the molecular formula C15H13ClFNO2 and a molecular weight of 299.75 g/mol. IUPAC name: 2-[2-(2-chloro-6-fluoroanilino)-3,4,6-trideuterio-5-(trideuteriomethyl)phenyl]acetic acid. InChIKey: KHPKQFYUPIUARC-UASVBIJOSA-N.
| Molecular formula | C15H13ClFNO2 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 2-[2-(2-chloro-6-fluoroanilino)-3,4,6-trideuterio-5-(trideuteriomethyl)phenyl]acetic acid |
| InChIKey | KHPKQFYUPIUARC-UASVBIJOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])CC(=O)O)NC2=C(C=CC=C2Cl)F)[2H] |
Computed by PubChem (NCBI)