CAS 1225505-29-2 appears in our catalog under these names: 3-(3-Chlorophenyl)-2,2-dimethylpropanoic acid, 98%, 3-(3-Chlorophenyl)-2,2-dimethylpropanoic acid, 3-Chloro-α,α-dimethylbenzenepropanoic acid, 97%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
3-(3-chlorophenyl)-2,2-dimethylpropanoic acid (CAS 1225505-29-2) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: 3-(3-chlorophenyl)-2,2-dimethylpropanoic acid. InChIKey: LAMMJZDDAHXYRQ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-2,2-dimethylpropanoic acid |
| InChIKey | LAMMJZDDAHXYRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)