CAS 1225525-30-3 is the registry number for N-​(2,​2-​Dimethylpropyl)​tetrahydro-​3-​thiophenamine 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(2,2-dimethylpropyl)-1,1-dioxothiolan-3-amine (CAS 1225525-30-3) is a chemical compound with the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. IUPAC name: N-(2,2-dimethylpropyl)-1,1-dioxothiolan-3-amine. InChIKey: SDBRUGZDKJVJKN-UHFFFAOYSA-N.
| Molecular formula | C9H19NO2S |
|---|---|
| Molecular weight | 205.32 g/mol |
| IUPAC name | N-(2,2-dimethylpropyl)-1,1-dioxothiolan-3-amine |
| InChIKey | SDBRUGZDKJVJKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CNC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)