CAS 1342244-28-3 is the registry number for 1-(Ethylsulfonyl)-4,4-dimethylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethylsulfonyl-4,4-dimethylpiperidine (CAS 1342244-28-3) is a chemical compound with the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. IUPAC name: 1-ethylsulfonyl-4,4-dimethylpiperidine. InChIKey: LLUNLZQOVDDMSX-UHFFFAOYSA-N.
| Molecular formula | C9H19NO2S |
|---|---|
| Molecular weight | 205.32 g/mol |
| IUPAC name | 1-ethylsulfonyl-4,4-dimethylpiperidine |
| InChIKey | LLUNLZQOVDDMSX-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCC(CC1)(C)C |
Computed by PubChem (NCBI)