CAS 1225574-45-7 appears in our catalog under these names: Ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate, 95%, Ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate (CAS 1225574-45-7) is a chemical compound with the molecular formula C13H13FO5 and a molecular weight of 268.24 g/mol. IUPAC name: ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: ITPCRIFSWAGHTH-UHFFFAOYSA-N.
| Molecular formula | C13H13FO5 |
|---|---|
| Molecular weight | 268.24 g/mol |
| IUPAC name | ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | ITPCRIFSWAGHTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=CC(=C1)F)OC |
Computed by PubChem (NCBI)