CAS 2368871-95-6 is the registry number for Ethyl 4-(4-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-(4-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate (CAS 2368871-95-6) is a chemical compound with the molecular formula C13H13FO5 and a molecular weight of 268.24 g/mol. IUPAC name: ethyl 4-(4-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: DKNCEKRIIIRJCJ-UHFFFAOYSA-N.
| Molecular formula | C13H13FO5 |
|---|---|
| Molecular weight | 268.24 g/mol |
| IUPAC name | ethyl 4-(4-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | DKNCEKRIIIRJCJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=C(C=C1)F)OC |
Computed by PubChem (NCBI)