CAS 1225665-70-2 appears in our catalog under these names: 3-(2-Fluorophenyl)pyrrolidine-2,5-dione, 3-(2-Fluorophenyl)pyrrolidine-2,5-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
3-(2-fluorophenyl)pyrrolidine-2,5-dione (CAS 1225665-70-2) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 3-(2-fluorophenyl)pyrrolidine-2,5-dione. InChIKey: PPSZALYDZSHGKC-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 3-(2-fluorophenyl)pyrrolidine-2,5-dione |
| InChIKey | PPSZALYDZSHGKC-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC1=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)