Products 1225790-45-3
CAS 1225790-45-3 is the registry number for 2-Bromo-4-(2-methoxy-4,5-dimethylphenyl)thiazole, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-(2-methoxy-4,5-dimethylphenyl)-1,3-thiazole (CAS 1225790-45-3) is a chemical compound with the molecular formula C12H12BrNOS and a molecular weight of 298.20 g/mol. IUPAC name: 2-bromo-4-(2-methoxy-4,5-dimethylphenyl)-1,3-thiazole. InChIKey: PCZNRLOKCVOXMT-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNOS |
|---|---|
| Molecular weight | 298.20 g/mol |
| IUPAC name | 2-bromo-4-(2-methoxy-4,5-dimethylphenyl)-1,3-thiazole |
| InChIKey | PCZNRLOKCVOXMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)OC)C2=CSC(=N2)Br |
Computed by PubChem (NCBI)