Products 2504202-16-6
CAS 2504202-16-6 is the registry number for 6-Bromo-2-(cyclobutylmethoxy)benzo[d]thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-bromo-2-(cyclobutylmethoxy)-1,3-benzothiazole (CAS 2504202-16-6) is a chemical compound with the molecular formula C12H12BrNOS and a molecular weight of 298.20 g/mol. IUPAC name: 6-bromo-2-(cyclobutylmethoxy)-1,3-benzothiazole. InChIKey: RAMAJGANMYKESS-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNOS |
|---|---|
| Molecular weight | 298.20 g/mol |
| IUPAC name | 6-bromo-2-(cyclobutylmethoxy)-1,3-benzothiazole |
| InChIKey | RAMAJGANMYKESS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)COC2=NC3=C(S2)C=C(C=C3)Br |
Computed by PubChem (NCBI)