Products 1225796-93-9
CAS 1225796-93-9 is the registry number for (4-(tert-butyl)phenyl)(4-ethylphenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-tert-butylphenyl)-(4-ethylphenyl)methanol (CAS 1225796-93-9) is a chemical compound with the molecular formula C19H24O and a molecular weight of 268.4 g/mol. IUPAC name: (4-tert-butylphenyl)-(4-ethylphenyl)methanol. InChIKey: DDXAPGXCNJPJIQ-UHFFFAOYSA-N.
| Molecular formula | C19H24O |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (4-tert-butylphenyl)-(4-ethylphenyl)methanol |
| InChIKey | DDXAPGXCNJPJIQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(C2=CC=C(C=C2)C(C)(C)C)O |
Computed by PubChem (NCBI)