CAS 21127-91-3 is the registry number for 2,4,6-Trimethyl-α-(2,4,6-trimethylphenyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Bis(2,4,6-trimethylphenyl)methanol (CAS 21127-91-3) is a chemical compound with the molecular formula C19H24O and a molecular weight of 268.4 g/mol. IUPAC name: bis(2,4,6-trimethylphenyl)methanol. InChIKey: RYAXQBPMRYXUHG-UHFFFAOYSA-N.
| Molecular formula | C19H24O |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | bis(2,4,6-trimethylphenyl)methanol |
| InChIKey | RYAXQBPMRYXUHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C2=C(C=C(C=C2C)C)C)O)C |
Computed by PubChem (NCBI)