Products 1226033-82-4

CAS 1226033-82-4 is the registry number for 2-(2-Methoxybenzyl)-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-methoxyphenyl)methyl]-3-methylbutanoic acid (CAS 1226033-82-4) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 2-[(2-methoxyphenyl)methyl]-3-methylbutanoic acid. InChIKey: OMHDQFPPHUBCRB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC name2-[(2-methoxyphenyl)methyl]-3-methylbutanoic acid
InChIKeyOMHDQFPPHUBCRB-UHFFFAOYSA-N
SMILESCC(C)C(CC1=CC=CC=C1OC)C(=O)O

Computed by PubChem (NCBI)