Products 1226104-42-2
CAS 1226104-42-2 is the registry number for 1-(2-(Aminomethyl)-3-methylbutyl)-2,4-dichlorobenzene. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[(2,4-dichlorophenyl)methyl]-3-methylbutan-1-amine (CAS 1226104-42-2) is a chemical compound with the molecular formula C12H17Cl2N and a molecular weight of 246.17 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methyl]-3-methylbutan-1-amine. InChIKey: CGRJLIWQASWIGI-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methyl]-3-methylbutan-1-amine |
| InChIKey | CGRJLIWQASWIGI-UHFFFAOYSA-N |
| SMILES | CC(C)C(CC1=C(C=C(C=C1)Cl)Cl)CN |
Computed by PubChem (NCBI)