Products 1226165-87-2
CAS 1226165-87-2 appears in our catalog under these names: 5-Cyclohexyloxazole-4-carboxylic acid, 95%, 5-Cyclohexyl-1,3-oxazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
5-cyclohexyl-1,3-oxazole-4-carboxylic acid (CAS 1226165-87-2) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 5-cyclohexyl-1,3-oxazole-4-carboxylic acid. InChIKey: XXTUSICQEKPFES-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 5-cyclohexyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | XXTUSICQEKPFES-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)