Products 1226365-40-7

CAS 1226365-40-7 is the registry number for 1-(2-Chloro-6-fluorobenzyl)-1H-indole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

1-[(2-chloro-6-fluorophenyl)methyl]indole-3-carboxylic acid (CAS 1226365-40-7) is a chemical compound with the molecular formula C16H11ClFNO2 and a molecular weight of 303.71 g/mol. IUPAC name: 1-[(2-chloro-6-fluorophenyl)methyl]indole-3-carboxylic acid. InChIKey: CGKXESZZPSJSIG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11ClFNO2
Molecular weight303.71 g/mol
IUPAC name1-[(2-chloro-6-fluorophenyl)methyl]indole-3-carboxylic acid
InChIKeyCGKXESZZPSJSIG-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2CC3=C(C=CC=C3Cl)F)C(=O)O

Computed by PubChem (NCBI)