CAS 170232-37-8 is the registry number for 3-Acetoxy-5-chloro-1-(4-fluorophenyl)-1H-indole. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
[5-chloro-1-(4-fluorophenyl)indol-3-yl] acetate (CAS 170232-37-8) is a chemical compound with the molecular formula C16H11ClFNO2 and a molecular weight of 303.71 g/mol. IUPAC name: [5-chloro-1-(4-fluorophenyl)indol-3-yl] acetate. InChIKey: ORYHRBOKCCLJRE-UHFFFAOYSA-N.
| Molecular formula | C16H11ClFNO2 |
|---|---|
| Molecular weight | 303.71 g/mol |
| IUPAC name | [5-chloro-1-(4-fluorophenyl)indol-3-yl] acetate |
| InChIKey | ORYHRBOKCCLJRE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CN(C2=C1C=C(C=C2)Cl)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)