CAS 1226389-57-6 appears in our catalog under these names: 5-Bromo-2-(4-methylpiperazin-1-yl)pyridin-3-amine, 5-Bromo-2-(4-methylpiperazin-1-yl)pyridin-3-amine, 98%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 1g, 250mg.
5-bromo-2-(4-methylpiperazin-1-yl)pyridin-3-amine (CAS 1226389-57-6) is a chemical compound with the molecular formula C10H15BrN4 and a molecular weight of 271.16 g/mol. IUPAC name: 5-bromo-2-(4-methylpiperazin-1-yl)pyridin-3-amine. InChIKey: BBXKIRALZZZBSM-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN4 |
|---|---|
| Molecular weight | 271.16 g/mol |
| IUPAC name | 5-bromo-2-(4-methylpiperazin-1-yl)pyridin-3-amine |
| InChIKey | BBXKIRALZZZBSM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)