CAS 2843690-95-7 is the registry number for (S)-3'-Bromo-4'H,6'H-spiro[piperidine-4,5'-pyrrolo[1,2-b]pyrazol]-4'-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-3-bromospiro[4,6-dihydropyrrolo[2,1-e]pyrazole-5,4'-piperidine]-4-amine (CAS 2843690-95-7) is a chemical compound with the molecular formula C10H15BrN4 and a molecular weight of 271.16 g/mol. IUPAC name: (4S)-3-bromospiro[4,6-dihydropyrrolo[2,1-e]pyrazole-5,4'-piperidine]-4-amine. InChIKey: QFOXKZKJEVJOTN-SECBINFHSA-N.
| Molecular formula | C10H15BrN4 |
|---|---|
| Molecular weight | 271.16 g/mol |
| IUPAC name | (4S)-3-bromospiro[4,6-dihydropyrrolo[2,1-e]pyrazole-5,4'-piperidine]-4-amine |
| InChIKey | QFOXKZKJEVJOTN-SECBINFHSA-N |
| SMILES | C1CNCCC12CN3C(=C(C=N3)Br)[C@H]2N |
Computed by PubChem (NCBI)