CAS 1226507-66-9 appears in our catalog under these names: (1S)-2,2,2-Trifluoro-1-(pyridin-3-yl)ethan-1-ol, 95%, (1S)-2,2,2-Trifluoro-1-(pyridin-3-yl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1S)-2,2,2-trifluoro-1-pyridin-3-ylethanol (CAS 1226507-66-9) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-pyridin-3-ylethanol. InChIKey: LHXKPHQPUHHFQW-LURJTMIESA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-pyridin-3-ylethanol |
| InChIKey | LHXKPHQPUHHFQW-LURJTMIESA-N |
| SMILES | C1=CC(=CN=C1)[C@@H](C(F)(F)F)O |
Computed by PubChem (NCBI)