CAS 1226806-27-4 is the registry number for 2-(4-Formyl-2,6-diiodophenoxy)acetonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-formyl-2,6-diiodophenoxy)acetonitrile (CAS 1226806-27-4) is a chemical compound with the molecular formula C9H5I2NO2 and a molecular weight of 412.95 g/mol. IUPAC name: 2-(4-formyl-2,6-diiodophenoxy)acetonitrile. InChIKey: WFXZGEYSFOWLPI-UHFFFAOYSA-N.
| Molecular formula | C9H5I2NO2 |
|---|---|
| Molecular weight | 412.95 g/mol |
| IUPAC name | 2-(4-formyl-2,6-diiodophenoxy)acetonitrile |
| InChIKey | WFXZGEYSFOWLPI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)OCC#N)I)C=O |
Computed by PubChem (NCBI)