CAS 17987-78-9 is the registry number for 6,8-Diiodo-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-diiodo-2-methyl-3,1-benzoxazin-4-one (CAS 17987-78-9) is a chemical compound with the molecular formula C9H5I2NO2 and a molecular weight of 412.95 g/mol. IUPAC name: 6,8-diiodo-2-methyl-3,1-benzoxazin-4-one. InChIKey: OPMJBYPHTDLWBE-UHFFFAOYSA-N.
| Molecular formula | C9H5I2NO2 |
|---|---|
| Molecular weight | 412.95 g/mol |
| IUPAC name | 6,8-diiodo-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | OPMJBYPHTDLWBE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2I)I)C(=O)O1 |
Computed by PubChem (NCBI)