CAS 1226808-72-5 is the registry number for Ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate (CAS 1226808-72-5) is a chemical compound with the molecular formula C11H11BrF2O2 and a molecular weight of 293.10 g/mol. IUPAC name: ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate. InChIKey: BPPFUEMXTDPKSJ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrF2O2 |
|---|---|
| Molecular weight | 293.10 g/mol |
| IUPAC name | ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate |
| InChIKey | BPPFUEMXTDPKSJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=CC(=C1)Br)C)(F)F |
Computed by PubChem (NCBI)