Products 1226808-72-5

CAS 1226808-72-5 is the registry number for Ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate (CAS 1226808-72-5) is a chemical compound with the molecular formula C11H11BrF2O2 and a molecular weight of 293.10 g/mol. IUPAC name: ethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate. InChIKey: BPPFUEMXTDPKSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BrF2O2
Molecular weight293.10 g/mol
IUPAC nameethyl 2-(5-bromo-2-methylphenyl)-2,2-difluoroacetate
InChIKeyBPPFUEMXTDPKSJ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=C(C=CC(=C1)Br)C)(F)F

Computed by PubChem (NCBI)